| Identification |
| Name: | prop-2-enoic acid - 2-hydroxypropyl prop-2-enoate (1:1) |
| Synonyms: | prop-2-enoic acid- 2-hydroxypropyl prop-2-enoate(1:1);110608-38-3;AC1L554O;AC1Q6383;AR-1L1860;2-Propenoic acid, monoester with 1,2-propanediol, polymer with 2-propenoic acid;2-hydroxypropyl prop-2-enoate; prop-2-enoic acid;prop-2-enoic acid - 2-hydroxypropyl prop-2-enoate (1:1);2-Propenoic acid, polymer with 1,2-propanediol mono-2-propenoate;116948-51-7;457899-97-7 |
| CAS: | 110608-38-3;116948-51-7;39373-34-7 |
| Molecular Formula: | C9H14O5 |
| Molecular Weight: | 202.2045 |
| InChI: | InChI=1/C6H10O3.C3H4O2/c1-3-6(8)9-4-5(2)7;1-2-3(4)5/h3,5,7H,1,4H2,2H3;2H,1H2,(H,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 79.9°C |
| Boiling Point: | 194.5°C at 760 mmHg |
| Flash Point: | 79.9°C |
| Safety Data |
| |
 |
