Identification |
Name: | Sebacoyl chloride |
Synonyms: | Sebacoylchloride (6CI,8CI);Decanedioic acid dichloride;Decanedioic dichloride;Decanedioyl chloride;NSC 56763;Sebacic acid chloride;Sebacic aciddichloride;Sebacic dichloride;Sebacoyl dichloride;Sebacyl chloride;Decanedioyl dichloride; |
CAS: | 111-19-3 |
EINECS: | 203-843-4 |
Molecular Formula: | C10H16Cl2O2 |
Molecular Weight: | 239.1382 |
InChI: | InChI=1S/C10H16Cl2O2/c11-9(13)7-5-3-1-2-4-6-8-10(12)14/h1-8H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN3129 |
Melting Point: | -2.5 deg C |
Density: | 1.135 g/cm3 |
Stability: | Reacts violently with water liberating toxic gas. Incompatible with water, oxidizing agents, amines, alcohols. |
Refractive index: | n20/D 1.468(lit.) |
Water Solubility: | MAY DECOMPOSE with water |
Solubility: | MAY DECOMPOSE with water |
Appearance: | light yellow Clear liquid |
Packinggroup: | II |
Storage Temperature: | 2-8°C |
Sensitive: | Moisture Sensitive |
Color: | yellow |
Safety Data |
Hazard Symbols |
C: Corrosive
|
|
 |