| Identification | |
| Name: | Adipoyl chloride |
| Synonyms: | Hexanedioyl dichloride;Adipoylchloride (6CI,8CI);1,4-Bis(chlorocarbonyl)butane;Adipic acid dichloride;Adipoyl dichloride;Adipyl chloride;Adipyl dichloride;Hexanedioic aciddichloride;Hexanedioic dichloride; |
| CAS: | 111-50-2 |
| EINECS: | 203-876-4 |
| Molecular Formula: | C6H8Cl2O2 |
| Molecular Weight: | 183.03 |
| InChI: | InChI=1/C6H8Cl2O2/c7-5(9)3-1-2-4-6(8)10/h1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.259 |
| Stability: | Stability Reacts violently with water to form hydrochloric acid. Incompatible with water, alcohols, bases, oxidizing agents. Protect from moisture. |
| Refractive index: | 1.47-1.472 |
| Water Solubility: | reacts |
| Solubility: | reacts |
| Appearance: | brown clear liquid |
| Specification: | colourless to dark brown liquid with a pungent odour Safety Statements:26-36/37/39-45-8 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 8:Keep container dry |
| Packinggroup: | II |
| Storage Temperature: | Refrigerator |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
