| Identification | |
| Name: | Benzene,1-methoxy-4-(2-propen-1-yl)- |
| Synonyms: | 1-Allyl-4-methoxybenzene;1-Allyl-4-methoxybenzol;p-Allylphenyl methyl ether;1-Methoxy-4-(prop-2-en-1-yl)benzene;Isoanethole;p-Allylmethoxybenzene;Esdragon;Allylphenyl methyl ether, p-;4-Allylanisole; |
| CAS: | 140-67-0 |
| EINECS: | 205-427-8 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3,5-8H,1,4H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.965 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5205-1.5225 |
| Solubility: | SOL IN ALCOHOL, CHLOROFORM Solubility in water at 25 deg C is 0.178 g/L. |
| Appearance: | colourless liquid with an aniseed smell |
| Specification: |
P-Allylanisole (140-67-0) isolated from rind of persea gratissima grath. and from oil of estragon. Found in oils of Russian anise, basil, fennel turpentine, tarragon oil, anise bark oil. |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
