| Identification | |
| Name: | Pyrazine,5-ethyl-2,3-dimethyl- |
| Synonyms: | 2,3-Dimethyl-5-ethylpyrazine;2,3-Dimethyl-6-ethylpyrazine; 2-Ethyl-5,6-dimethylpyrazine;5-Ethyl-2,3-dimethylpyrazine |
| CAS: | 15707-34-3 |
| Molecular Formula: | C8H12 N2 |
| Molecular Weight: | 136.19 |
| InChI: | InChI=1/C8H12N2/c1-4-8-5-9-6(2)7(3)10-8/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.964 g/cm3 |
| Refractive index: | 1.501 |
| Water Solubility: | Insoluble in water, soluble in alcohol |
| Solubility: | Insoluble in water, soluble in alcohol |
| Specification: |
2,3-Dimethyl-5-ethylpyrazine , its cas register number is 15707-34-3. It also can be called Pyrazine, 5-ethyl-2,3-dimethyl- ; and 5-Ethyl-2,3-dimethylpyrazine . |
| Safety Data | |
 |
|
