| Identification | |
| Name: | 2,3-dimethylphenyl isocyanate |
| Synonyms: | - |
| CAS: | 1591-99-7 |
| Molecular Formula: | C9H9NO |
| Molecular Weight: | 147.17 |
| InChI: | InChI=1/C9H9NO/c1-7-4-3-5-9(8(7)2)10-6-11/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2206 6.1/PG 3 |
| Density: | 104 |
| Refractive index: | n20/D 1.54(lit.) |
| Appearance: | clear slightly yellow liquid |
| Specification: | Clear slightly yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
