Identification |
Name: | 2,3-dimethylphenyl isocyanate |
Synonyms: | - |
CAS: | 1591-99-7 |
Molecular Formula: | C9H9NO |
Molecular Weight: | 147.17 |
InChI: | InChI=1/C9H9NO/c1-7-4-3-5-9(8(7)2)10-6-11/h3-5H,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2206 6.1/PG 3 |
Density: | 104 |
Refractive index: | n20/D 1.54(lit.) |
Appearance: | clear slightly yellow liquid |
Specification: | Clear slightly yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Packinggroup: | III |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |