| Identification | |
| Name: | Trimethylselenonium chloride |
| Synonyms: | TRIMETHYLSELENONIUMCHLORIDE |
| CAS: | 18987-38-7 |
| Molecular Formula: | C3H9Se . Cl |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C3H9Se.ClH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Trimethylselenonium chloride , its cas register number is 18987-38-7. It also can be called Benzenesulfinic acid, sodium salt, dihydrate ; and Selenonium, trimethyl-, chloride . |
| Flash Point: | °C |
| Safety Data | |
 |
|
