| Identification | |
| Name: | Potassium amylxanthate |
| Synonyms: | Carbonicacid, dithio-, O-pentyl ester, potassium salt (8CI);Carbonodithioic acid,O-pentyl ester, potassium salt (9CI);Xanthic acid, pentyl-, potassium salt(6CI);Amyl potassium xanthate;Potassiumamylxanthate;Potassium n-amylxanthogenate;Potassium pentyl xanthate;Potassium pentyl xanthogenate; |
| CAS: | 2720-73-2 |
| EINECS: | 220-329-5 |
| Molecular Formula: | C6H11OS2K |
| Molecular Weight: | 164.28 |
| InChI: | InChI=1/C6H12OS2.K/c1-2-3-4-5-7-6(8)9;/h2-5H2,1H3,(H,8,9);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3342 |
| Appearance: | Yellow or yellowish powder or pellet |
| Specification: |
? Potassium amylxanthate (CAS NO.2720-73-2) is used in the processing of metal of collector. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Safety Data | |
 |
|
