| Identification | |
| Name: | Ethanone,1-(3-chloro-4-fluorophenyl)- |
| Synonyms: | 1-(3-Chloro-4-fluorophenyl)ethan-1-one; |
| CAS: | 2923-66-2 |
| EINECS: | -0 |
| Molecular Formula: | C8H6ClFO |
| Molecular Weight: | 172.58 |
| InChI: | InChI=1/C2HF3O/c3-1(4)2(5)6/h1H |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 126 °C |
| Density: | 1.3g/cm3 |
| Refractive index: | 1.247 |
| Specification: | Safety Statements:26-36/37/39-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
