| Identification | |
| Name: | Propylene glycol monobutyrate |
| Synonyms: | Butanoic acid, monoester with 1,2-propanediol;Butyric acid, monoester with propane-1,2-diol;2-hydroxypropyl butanoate |
| CAS: | 29592-95-8 |
| EINECS: | 249-708-3 |
| Molecular Formula: | C7H14O3 |
| Molecular Weight: | 146.1843 |
| InChI: | InChI=1/C7H14O3/c1-3-4-7(9)10-5-6(2)8/h6,8H,3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 91.5°C |
| Boiling Point: | 228.4°C at 760 mmHg |
| Density: | 1.005g/cm3 |
| Refractive index: | 1.432 |
| Flash Point: | 91.5°C |
| Safety Data | |
 |
|
