| Identification | |
| Name: | 2-methylprop-2-enoic acid - 2-methyl-N-(2-phenylpropyl)prop-2-enamide (1:1) |
| Synonyms: | Methacrylamide, N-phenethyl-, polymer with methacrylic acid;Methacrylic acid, polymer with N-phenethylmethacrylamide;N-Methacryloyl-beta-phenethylamine, copolymer with methacrylic acid;2-methylprop-2-enoic acid- 2-methyl-n-(2-phenylpropyl)prop-2-enamide(1:1);37129-92-3;AC1L507U;AC1Q5R84;AR-1E4138;LS-89942;2-methyl-N-(2-phenylpropyl)prop-2-enamide; 2-methylprop-2-enoic acid;2-methylprop-2-enoic acid - 2-methyl-N-(2-phenylpropyl)prop-2-enamide (1:1) |
| CAS: | 37129-92-3 |
| Molecular Formula: | C17H23NO3 |
| Molecular Weight: | 289.3694 |
| InChI: | InChI=1/C13H17NO.C4H6O2/c1-10(2)13(15)14-9-11(3)12-7-5-4-6-8-12;1-3(2)4(5)6/h4-8,11H,1,9H2,2-3H3,(H,14,15);1H2,2H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 222.8°C |
| Boiling Point: | 370.8°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 222.8°C |
| Safety Data | |
 |
|
