Identification |
Name: | pentan-2-ol, triester with boric acid |
Synonyms: | Pentan-2-ol, triester with boric acid;tris(1-methylbutoxy)borane |
CAS: | 40589-08-0 |
EINECS: | 254-985-9 |
Molecular Formula: | C15H33BO3 |
Molecular Weight: | 272.2317 |
InChI: | InChI=1/C15H33BO3/c1-7-10-13(4)17-16(18-14(5)11-8-2)19-15(6)12-9-3/h13-15H,7-12H2,1-6H3 |
Molecular Structure: |
![(C15H33BO3) Pentan-2-ol, triester with boric acid;tris(1-methylbutoxy)borane](https://img.guidechem.com/pic/image/40589-08-0.gif) |
Properties |
Flash Point: | 65.8°C |
Boiling Point: | 240.9°C at 760 mmHg |
Density: | 0.855g/cm3 |
Refractive index: | 1.417 |
Flash Point: | 65.8°C |
Safety Data |
|
![](/images/detail_15.png) |