Identification |
Name: | 4-Fluorophenylacetyl chloride |
Synonyms: | - |
CAS: | 459-04-1 |
EINECS: | -0 |
Molecular Formula: | C8H6ClFO |
Molecular Weight: | 172.584043 |
InChI: | InChI=1S/C8H6ClFO/c9-8(11)5-6-1-3-7(10)4-2-6/h1-4H,5H2 |
Molecular Structure: |
 |
Properties |
Transport: | 3265 |
Melting Point: | 47-48ºC |
Density: | 1.259 |
Refractive index: | 1.511-1.513 |
Water Solubility: | reacts with water |
Solubility: | reacts with water |
Appearance: | clear yellow liquid. |
Specification: | clear yellow liquid Safety Statements:45-36/37/39-26-27 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 27:Take off immediately all contaminated clothing |
Packinggroup: | II |
Storage Temperature: | Store at RT. |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
Xi: Irritant
C: Corrosive
|
|
 |