Identification |
Name: | Benzenesulfonylisocyanate, 4-nitro- |
Synonyms: | Benzenesulfonicacid, p-nitro-, anhydride with isocyanic acid (6CI,7CI,8CI); Isocyanic acid,anhydride with p-nitrobenzenesulfonic acid; (4-Nitrophenyl)sulfonyl isocyanate;(p-Nitrophenyl)sulfonyl isocyanate; 4-Nitrobenzenesulfonyl isocyanate;p-Nitrobenzenesulfonylisocyanate |
CAS: | 5769-16-4 |
Molecular Formula: | C7H4 N2 O5 S |
Molecular Weight: | 363.8849 |
InChI: | InChI=1/C16H14ClN3OS2/c1-9-13(15(21)19-11-6-4-10(17)5-7-11)14(20-16(22)18-9)12-3-2-8-23-12/h2-8,14H,1H3,(H,19,21)(H2,18,20,22) |
Molecular Structure: |
![(C7H4N2O5S) Benzenesulfonicacid, p-nitro-, anhydride with isocyanic acid (6CI,7CI,8CI); Isocyanic acid,anhydride...](https://img1.guidechem.com/chem/e/dict/67/5769-16-4.jpg) |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.45g/cm3 |
Refractive index: | 1.712 |
Flash Point: | °C |
Safety Data |
|
![](/images/detail_15.png) |