| Identification |
| Name: | butyl 2-hydroxypropanoate; ethyl prop-2-enoate; methyl 2-methylprop-2-enoate |
| Synonyms: | AC1O5ATL;Butyl lactate, ethyl acrylate, methyl methacrylate polymer;butyl 2-hydroxypropanoate; ethyl prop-2-enoate; methyl 2-methylprop-2-enoate;2-Propenoic acid, 2-methyl-, methyl ester, polymer with butyl 2-hydroxypropanoate and ethyl 2-propenoate;65379-49-9 |
| CAS: | 65379-49-9 |
| Molecular Formula: | C17H30O7 |
| Molecular Weight: | 346.4159 |
| InChI: | InChI=1/C7H14O3.2C5H8O2/c1-3-4-5-10-7(9)6(2)8;1-4(2)5(6)7-3;1-3-5(6)7-4-2/h6,8H,3-5H2,1-2H3;1H2,2-3H3;3H,1,4H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 71°C |
| Boiling Point: | 189.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 71°C |
| Safety Data |
| |
 |
