| Identification |
| Name: | dioctyl hydrogen phosphate, compound with N,N-dimethyloctadecylamine (1:1) |
| Synonyms: | Phosphoric acid, dioctyl ester, compd. with N,N-dimethyl-1-octadecanamine (1:1);Dioctyl hydrogen phosphate, compound with N,N-dimethyloctadecylamine (1:1);dioctyl hydrogen phosphate - N,N-dimethyloctadecan-1-amine (1:1) |
| CAS: | 67846-19-9 |
| EINECS: | 267-363-7 |
| Molecular Formula: | C36H78NO4P |
| Molecular Weight: | 619.9826 |
| InChI: | InChI=1/C20H43N.C16H35O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-3-5-7-9-11-13-15-19-21(17,18)20-16-14-12-10-8-6-4-2/h4-20H2,1-3H3;3-16H2,1-2H3,(H,17,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 153.8°C |
| Boiling Point: | 348.5°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 153.8°C |
| Safety Data |
| |
 |
