Identification |
Name: | 2-Propenoic acid, 2-methyl-, polymer with methyl 2-methyl-2-propenoate and 1,2-propanediol mono(2-methyl-2-propenoate) |
Synonyms: | 2-Propenoic acid, 2-methyl-, polymer with methyl 2-methyl-2-propenoate and 1,2-propanediol mono(2-methyl-2-propenoate) |
CAS: | 67874-27-5 |
Molecular Formula: | C17H22O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C17H22O2/c1-17(2)13-9-8-12(10-13)14(17)11-19-16-7-5-4-6-15(16)18-3/h4-7,11-13H,8-10H2,1-3H3/b14-11+ |
Molecular Structure: |
|
Properties |
Flash Point: | 132.8°C |
Boiling Point: | 357.3°C at 760 mmHg |
Density: | 1.091g/cm3 |
Refractive index: | 1.58 |
Flash Point: | 132.8°C |
Safety Data |
|
|