| Identification |
| Name: | octanoic acid, compound with 2-(diethylamino)ethanol (1:1) |
| Synonyms: | Octanoic acid, compd. with 2-(diethylamino)ethanol (1:1);Diethylethanolamine caprylate;Octanoic acid diethylethanolamine salt;Octanoic acid, compound with 2-(diethylamino)ethanol (1:1);octanoic acid - 2-(diethylamino)ethanol (1:1) |
| CAS: | 68052-35-7 |
| EINECS: | 268-317-9 |
| Molecular Formula: | C14H31NO3 |
| Molecular Weight: | 261.4008 |
| InChI: | InChI=1/C8H16O2.C6H15NO/c1-2-3-4-5-6-7-8(9)10;1-3-7(4-2)5-6-8/h2-7H2,1H3,(H,9,10);8H,3-6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 107.4°C |
| Boiling Point: | 239.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 107.4°C |
| Safety Data |
| |
 |
