| Identification |
| Name: | oleic acid, compound with 2-amino-2-methylpropan-1-ol (1:1) |
| Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with 2-amino-2-methyl-1-propanol (1:1);2-Amino-2-methyl-1-propanol, oleate (salt);2-Amino-2-methylpropanol salt of oleic acid;Oleic acid, compd. with 2-amino-2-methylpropanol (1:1);Oleic acid, isobutanolamine salt;9-Octadecenoic acid (Z)-, compd. with 2-amino-2-methyl-1-propanol (1:1);Oleic acid, compound with 2-amino-2-methylpropan-1-ol (1:1);(9Z)-octadec-9-enoic acid - 2-amino-2-methylpropan-1-ol (1:1) |
| CAS: | 68140-41-0 |
| EINECS: | 268-793-8 |
| Molecular Formula: | C22H45NO3 |
| Molecular Weight: | 371.5976 |
| InChI: | InChI=1/C18H34O2.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2,5)3-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);6H,3,5H2,1-2H3/b10-9-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Flash Point: | 270.1°C |
| Safety Data |
| |
 |
