Identification |
Name: | oleic acid, compound with 2,2',2''-nitrilotri(propan-2-ol) (1:1) |
Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with 2,2',2''-nitrilotris(2-propanol) (1:1);Oleic acid, compd. with triisopropanolamine (1:1);Oleic acid, compound with 2,2',2''-nitrilotri(propan-2-ol) (1:1);(9Z)-octadec-9-enoic acid - 2,2',2''-nitrilotripropan-2-ol (1:1) |
CAS: | 68527-64-0 |
EINECS: | 271-273-3 |
Molecular Formula: | C27H55NO5 |
Molecular Weight: | 473.7293 |
InChI: | InChI=1/C18H34O2.C9H21NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-7(2,11)10(8(3,4)12)9(5,6)13/h9-10H,2-8,11-17H2,1H3,(H,19,20);11-13H,1-6H3/b10-9-; |
Molecular Structure: |
|
Properties |
Flash Point: | 270.1°C |
Boiling Point: | 360°C at 760 mmHg |
Flash Point: | 270.1°C |
Safety Data |
|
|