| Identification | |
| Name: | 6'-Chloro-3-(methylamino)-o-propionotoluidide hydrochloride |
| Synonyms: | C 3162;6'-Chloro-3-(methylamino)-o-propionotoluidide hydrochloride;o-Propionotoluidide, 6'-chloro-3-(methylamino)-, hydrochloride;AC1MHZTF;LS-124988;N-(2-chloro-6-methylphenyl)-3-(methylamino)propanamide hydrochloride;78218-38-9 |
| CAS: | 78218-38-9 |
| Molecular Formula: | C11H15ClN2O . ClH |
| Molecular Weight: | 263.1635 |
| InChI: | InChI=1/C11H15ClN2O.ClH/c1-8-4-3-5-9(12)11(8)14-10(15)6-7-13-2;/h3-5,13H,6-7H2,1-2H3,(H,14,15);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 182.6°C |
| Boiling Point: | 378.2°C at 760 mmHg |
| Specification: |
6'-Chloro-3-(methylamino)-o-propionotoluidide hydrochloride , its cas register number is 78218-38-9. It also can be called o-Propionotoluidide, 6'-chloro-3-(methylamino)-, hydrochloride . Its classification code are Drug / Therapeutic Agent and Skin / Eye Irritant. |
| Flash Point: | 182.6°C |
| Safety Data | |
 |
|
