Identification |
Name: | but-3-enoic acid; oxiran-2-ylmethyl 2-methylprop-2-enoate |
Synonyms: | 26660-37-7;AC1L525U;Ethenyl acetate, polymer with oxiranylmethyl 2-methyl-2-propenoate;Vinyl acetate-glycidyl methacrylate copolymer;but-3-enoic acid; oxiran-2-ylmethyl 2-methylprop-2-enoate;but-3-enoic acid - oxiran-2-ylmethyl 2-methylprop-2-enoate (1:1);2-Propenoic acid, 2-methyl-, 2-oxiranylmethyl ester, polymer with ethenyl acetate;2-Propenoic acid, 2-methyl-, oxiranylmethyl ester, polymer with ethenyl acetate |
CAS: | 80893-34-1 |
Molecular Formula: | C11H16O5 |
Molecular Weight: | 228.24174 |
InChI: | InChI=1S/C7H10O3.C4H6O2/c1-5(2)7(8)10-4-6-3-9-6;1-2-3-4(5)6/h6H,1,3-4H2,2H3;2H,1,3H2,(H,5,6) |
Molecular Structure: |
 |
Properties |
Safety Data |
|
 |