| Identification | |
| Name: | 2-Diethylaminoethylchloride hydrochloride |
| CAS: | 869-24-9 |
| EINECS: | 212-786-4 |
| Molecular Formula: | C6H14ClN?HCl |
| Molecular Weight: | 172.1 |
| InChI: | InChI=1/C6H14ClN.ClH/c1-3-8(4-2)6-5-7;/h3-6H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | miscible AUTOIGNITION |
| Appearance: | Clear to beige Crystals |
| Packinggroup: | II |
| HS Code: | 29211980 |
| Storage Temperature: | Poison room |
| Sensitive: | Moisture Sensitive |
| Usage: | 2-Chloro-N,N-diethylethylamine hydrochloride (DEC) is used as intermediate for the syntheses of pharmaceuticals (e.g. amiodarone, butetamate citrate, flurazepam and naftidrofuryl). Product Data Sheet |
| Safety Data | |
| Hazard Symbols | |
 |
|
