Identification |
Name: | Poly[oxy(methyl-1,2-ethanediyl)],a-butyl-w-hydroxy- |
Synonyms: | AdekaCarpol MP 370; B 01/10; B 01/20; B 01/40; B 01/80; BP 18100Si; Breox B 225;Butoxypolypropylene glycol; Desmophen 3500; Fluid AP; L 7500; LB 285; MOM810-2; Nasfroth 301; Newpol LB 1715; Newpol LB 1800X; Newpol LB 285; Newpol LB3000; Newpol LB 385; Newpol LB 65; Nissan Unilube MB 11; Nissan Unilube MB 14;Nissan Unilube MB 19; Nissan Unilube MB 2; Nissan Unilube MB 22; Nissan UnilubeMB 370; Nissan Unilube MB 38; Nissan Unilube MB 7; Nissan Unilube MB 700; OPSB;PPG-14 Butyl Ether; PPG-16 Butyl Ether; PPG-33 Butyl Ether; Pluriol A 1350P;Poly(oxypropylene) butyl ether; Poly(propylene oxide) monobutyl ether; Poly-GWI 165; Polyglycol 01/40; Polyglycol B 01/20; Polyglycol L 1150; Polyglycol L910; Polyoxypropylene ether with 1-butanol; Polyoxypropylene glycol butylmonoether; Polyoxypropylene monobutyl ether; Polypropylene glycol butyl ether;Polypropylene glycol monobutyl ether; Synalox 100-150B; Synalox 100-50B;Synalox PB 285; Ucon Fluid AP; Ucon LB 1145; Ucon LB 165; Ucon LB 1715; Ucon LB250; Ucon LB 285; Ucon LB 3000; Ucon LB 525; Ucon LB 625; Unilube MB 11;Unilube MB 14; Unilube MB 19; Unilube MB 2; Unilube MB 22; Unilube MB 370;Unilube MB 38; Unilube MB 7; Unilube MB 700 |
CAS: | 9003-13-8 |
EINECS: | 500-003-1 |
Molecular Formula: | (C3H6 O)n C4 H10 O |
Molecular Weight: | 0 |
InChI: | InChI=1/C10H22O3/c1-4-5-6-12-8-10(3)13-7-9(2)11/h9-11H,4-8H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 96.1°C |
Boiling Point: | 261.7°Cat760mmHg |
Density: | 0.93g/cm3 |
Refractive index: | n20/D 1.45 |
Specification: | usageEng:Hydraulic fluids, metal working fluids and lubricants, heat transfer fluids, solder assist fluids, quenchants, lubricants, solvents, plasticizers and foam control agents. |
Flash Point: | 96.1°C |
Usage: | Hydraulic fluids, metal working fluids and lubricants, heat transfer fluids, solder assist fluids, quenchants, lubricants, solvents, plasticizers and foam control agents. |
Safety Data |
|
 |