| Identification | |
| Name: | 4-Bromobutyryl chloride |
| Synonyms: | 4-Bromobutanoic acid chloride;4-Bromobutanoyl chloride;4-Bromobutyroylic chloride; |
| CAS: | 927-58-2 |
| EINECS: | 213-154-0 |
| Molecular Formula: | C4H6BrClO |
| Molecular Weight: | 185.45 |
| InChI: | InChI=1/C4H6BrClO/c5-3-1-2-4(6)7/h1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.602 |
| Refractive index: | 1.491-1.494 |
| Appearance: | clear colorless to slightly yellow |
| Specification: |
? 4-Bromobutyryl chloride , with CAS number of 927-58-2, can be called 4-Bromobutanoic acid chloride ; 4-Bromobutanoyl chloride ; 4-Bromobutyroylic chloride . |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
