| Identification | |
| Name: | 7-Methylindole |
| Synonyms: | 7-Methyl-1H-indole; 1H-Indole, 7-methyl-; |
| CAS: | 933-67-5 |
| EINECS: | 213-270-1 |
| Molecular Formula: | C9H9N |
| Molecular Weight: | 131.18 |
| InChI: | InChI=1/C9H9N/c1-7-3-2-4-8-5-6-10-9(7)8/h2-6,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 110.5°C |
| Density: | 266 |
| Stability: | No data. |
| Refractive index: | 1.576 (99.6 C) |
| Water Solubility: | negligible |
| Solubility: | SOLVENT |
| Appearance: | off white crystals |
| Flash Point: | 110.5°C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Light Sensitive |
| Usage: | Used in the production of agricultural chemicals and pharmaceuticals. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
