| Identification |
| Name: | 2-ethylhexyl prop-2-enoate - ethenylbenzene (1:1) |
| Synonyms: | 2-Propenoic acid, 2-ethylhexyl ester, polymer with ethenylbenzene;126830-06-6;25153-46-2;Styrene, 2-ethylhexyl acrylate polymer;AC1L51M6;2-ethylhexyl prop-2-enoate; styrene;2-Ethylhexyl acrylate styrene polymer;Styrene-2-ethylhexyl acrylate copolymer;2-ethylhexyl prop-2-enoate - ethenylbenzene (1:1);Ethenylbenzene, 2-ethylhexyl 2-propenoate copolymer;Benzene, ethenyl-, polymer with 2-ethylhexyl 2-propenoate;57608-12-5;58392-34-0;905307-38-2;945724-77-6 |
| CAS: | 126830-06-6;25153-46-2;57608-12-5;58392-34-0;9060-84-8 |
| Molecular Formula: | C19H28O2 |
| Molecular Weight: | 288.4244 |
| InChI: | InChI=1/C11H20O2.C8H8/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-2-8-6-4-3-5-7-8/h6,10H,3-5,7-9H2,1-2H3;2-7H,1H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 79.4°C |
| Boiling Point: | 216°C at 760 mmHg |
| Flash Point: | 79.4°C |
| Safety Data |
| |
 |
