| Identification |
| Name: | (Z)-4-ethoxy-4-oxo-but-2-enoic acid; ethylene; 2-methylprop-2-enoate |
| Synonyms: | AC1O5VS5;2-Butenedioic acid (Z)-, monoethyl ester, polymer with ethene and methyl 2-propenoate;ethene; (Z)-4-ethoxy-4-oxobut-2-enoic acid; 2-methylprop-2-enoate;2-Butenedioic acid (2Z)-, 1-ethyl ester, polymer with ethene and methyl 2-propenoate;2-Butenedioic acid (2Z)-, monoethyl ester, polymer with ethene and methyl 2-propenoate;54545-50-5;71215-67-3 |
| CAS: | 54545-50-5;71215-67-3 |
| Molecular Formula: | C12H17O6 |
| Molecular Weight: | 257.2603 |
| InChI: | InChI=1/C6H8O4.C4H6O2.C2H4/c1-2-10-6(9)4-3-5(7)8;1-3(2)4(5)6;1-2/h3-4H,2H2,1H3,(H,7,8);1H2,2H3,(H,5,6);1-2H2/p-1/b4-3-;; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 109.6°C |
| Boiling Point: | 261.6°C at 760 mmHg |
| Flash Point: | 109.6°C |
| Safety Data |
| |
 |
