| Identification | |
| Name: | p-Nitroaniline |
| Synonyms: | Aniline,p-nitro- (8CI);1-Amino-4-nitrobenzene;4-Amino-1-nitrobenzene;4-Aminonitrobenzene;4-Nitro-1-aminobenzene; |
| CAS: | 100-01-6 |
| EINECS: | 202-810-1 |
| Molecular Formula: | C6H6N2O2 |
| Molecular Weight: | 138.12 |
| InChI: | InChI=1/C6H6N2O2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1661 |
| Density: | 1.437 |
| Stability: | Stable. Incompatible with sodium hydroxide, strong oxidizing agents, strong reducing agents. May attack some plastics, rubber and coatings. May decompose explosively in the presence of initiators. Moisture sensitive. May be light and air-sensitive. |
| Refractive index: | 1.5401 (160 C) |
| Appearance: | yellow solid with a mild odor |
| Packinggroup: | II |
| HS Code: | 29214210 |
| Storage Temperature: | Store at R.T. |
| Color: | yellow |
| Usage: | Medication (vet). |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
