| Identification | |
| Name: | 2,4,5-trichlorophenyl prop-2-enoate - aziridine (1:1) |
| Synonyms: | Acrylic acid, 2,4,5-trichlorophenyl ester compd. with aziridine;Aziridine, compd with 2,4,5-trichlorophenyl acrylate;Reaction product of acrylic acid, 2,4,5-trichlorophenyl ester and ethyleneimine;AC1MI6XK;LS-14745;aziridine; (2,4,5-trichlorophenyl) prop-2-enoate;101952-47-0 |
| CAS: | 101952-47-0 |
| Molecular Formula: | C11H10Cl3NO2 |
| Molecular Weight: | 294.5616 |
| InChI: | InChI=1/C9H5Cl3O2.C2H5N/c1-2-9(13)14-8-4-6(11)5(10)3-7(8)12;1-2-3-1/h2-4H,1H2;3H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 145.6°C |
| Boiling Point: | 338.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 145.6°C |
| Safety Data | |
 |
|
