| Identification |
| Name: | Carbonic acid, thio-,anhydrosulfide with dithioveratrylcarbamic acid, ethyl ester (8CI) |
| Synonyms: | Carbonic acid, thio-, anhydrosulfide with dithioveratrylcarbamic acid, ethyl ester;Thiocarbonic acid anhydrosulfide with dithioveratrylcarbamic acid ethyl ester;AC1MHUPQ;LS-52116;ethyl (3,4-dimethoxyphenyl)methylcarbamothioylsulfanylformate;22623-49-0 |
| CAS: | 22623-49-0 |
| Molecular Formula: | C13H17 N O4 S2 |
| Molecular Weight: | 315.4084 |
| InChI: | InChI=1/C13H17NO4S2/c1-4-18-13(15)20-12(19)14-8-9-5-6-10(16-2)11(7-9)17-3/h5-7H,4,8H2,1-3H3,(H,14,19) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 214.4°C |
| Boiling Point: | 430.9°Cat760mmHg |
| Density: | 1.256g/cm3 |
| Refractive index: | 1.581 |
| Flash Point: | 214.4°C |
| Safety Data |
| |
 |
