Identification |
Name: | 4-Chlorobenzeneacetyl chloride |
Synonyms: | p-Chlorophenylacetyl Chloride; |
CAS: | 25026-34-0 |
EINECS: | 246-571-1 |
Molecular Formula: | C8H6Cl2O |
Molecular Weight: | 189.04 |
InChI: | InChI=1/C8H6Cl2O/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3265 8 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.55-1.552 |
Alpha: | -56.7 º |
Water Solubility: | REACTS with water |
Solubility: | REACTS with water |
Appearance: | clear yellow to brown liquid |
Packinggroup: | II |
Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |