| Identification |
| Name: | 4-Chlorobenzeneacetyl chloride |
| Synonyms: | p-Chlorophenylacetyl Chloride; |
| CAS: | 25026-34-0 |
| EINECS: | 246-571-1 |
| Molecular Formula: | C8H6Cl2O |
| Molecular Weight: | 189.04 |
| InChI: | InChI=1/C8H6Cl2O/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 8 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.55-1.552 |
| Alpha: | -56.7 º |
| Water Solubility: | REACTS with water |
| Solubility: | REACTS with water |
| Appearance: | clear yellow to brown liquid |
| Packinggroup: | II |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
