| Identification | |
| Name: | Dimethyl tetrahydrophthalate |
| Synonyms: | 1-Cyclohexene-1,2-dicarboxylic acid dimethyl ester |
| CAS: | 4336-19-0 |
| Molecular Formula: | C10H14O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H14O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 124.4°C |
| Boiling Point: | 262.6°C at 760 mmHg |
| Density: | 1.159g/cm3 |
| Refractive index: | 1.486 |
| Specification: |
Dimethyl tetrahydrophthalate , its cas register number is 4336-19-0. It also can be called 1-Cyclohexene-1,2-dicarboxylic acid, dimethyl ester ; BRN 2050919 ; Tetrahydrophthalic acid dimethyl ester ; and Dimethylester kyseliny tetrahydroftalove . |
| Flash Point: | 124.4°C |
| Safety Data | |
 |
|
