| Identification | |
| Name: | 2-ethylhexyl thioglycolate |
| Synonyms: | 2-ethylhexyl mercaptoacetate; Thioglycolic acid 2-ethylhexyl ester; Isooctyl mercaptoacetate; Isooctyl thiohydroxy acetate; TGB |
| CAS: | 7659-86-1 |
| EINECS: | 231-626-4 |
| Molecular Formula: | C10H20O2S |
| Molecular Weight: | 204.3296 |
| InChI: | InChI=1S/C10H20O2S/c1-3-5-6-9(4-2)7-12-10(11)8-13/h9,13H,3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Melting Point: | -31 C |
| Flash Point: | 112 -114 C |
| Density: | 0.972 |
| Refractive index: | n20/D 1.461 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | Clear liquid |
| Specification: | Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Flash Point: | 112 -114 C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
