Identification |
Name: | 2-Propenamide,2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1R)-1-phenylethyl]-, (2E)- |
Synonyms: | 2-Propenamide,2-cyano-3-(3,4-dihydroxyphenyl)-N-(1-phenylethyl)-, [R-(E)]-; Tyrphostin AG527; Tyrphostin B 44 |
CAS: | 133550-32-0 |
Molecular Formula: | C18H16 N2 O3 |
Molecular Weight: | 308.33 |
InChI: | InChI=1/C18H16N2O3/c1-12(14-5-3-2-4-6-14)20-18(23)15(11-19)9-13-7-8-16(21)17(22)10-13/h2-10,12,21-22H,1H3,(H,20,23)/b15-9+/t12-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 318.5°C |
Boiling Point: | 603°C at 760 mmHg |
Density: | 1.299g/cm3 |
Refractive index: | 1.66 |
Biological Activity: | Potent inhibitor of epidermal growth factor receptor (EGFR) kinase (IC 50 = 0.4 μ M), more active than the (+) enantiomer ((S)-(E)-2-Cyano-3-(3',4'-dihydroxyphenyl)-N-(1-phenylethyl)-2-propenamide ). Selective over ErbB2. |
Flash Point: | 318.5°C |
Storage Temperature: | −20°C |
Safety Data |
|
|