| Identification |
| Name: | 2-Propenamide,2-cyano-3-(3,4-dihydroxyphenyl)-N-phenyl-, (2E)- |
| Synonyms: | N-Phenyl-3,4-dihydroxybenzylidenecyanoacetamide; |
| CAS: | 133550-35-3 |
| Molecular Formula: | C16H12N2O3 |
| Molecular Weight: | 280.2781 |
| InChI: | InChI=1/C16H12N2O3/c17-10-12(8-11-6-7-14(19)15(20)9-11)16(21)18-13-4-2-1-3-5-13/h1-9,19-20H,(H,18,21)/b12-8+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 308.8 ºC |
| Boiling Point: | 586.9 ºCat 760 mmHg |
| Density: | 1.416 g/cm3 |
| Refractive index: | 1.736 |
| Biological Activity: | Potent inhibitor of epidermal growth factor receptor (EGFR) kinase (IC 50 = 0.7 μ M). Selective over ErbB2, PDGFR and insulin receptor kinase (IC 50 values are 42, 6 and > 100 μ M respectively). |
| Flash Point: | 308.8 ºC |
| Storage Temperature: | −20°C |
| Safety Data |
| |
 |
