Identification |
Name: | 2-Propenamide,2-cyano-3-(3,4-dihydroxyphenyl)-N-(3-phenylpropyl)-, (2E)- |
Synonyms: | N-(3'-Phenylpropyl)-3,4-dihydroxybenzylidenecyanoacetamide; |
CAS: | 133550-34-2 |
Molecular Formula: | C19H18N2O3 |
Molecular Weight: | 322.36 |
InChI: | InChI=1/C19H18N2O3/c20-13-16(11-15-8-9-17(22)18(23)12-15)19(24)21-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12,22-23H,4,7,10H2,(H,21,24)/b16-11+ |
Molecular Structure: |
 |
Properties |
Flash Point: | 329.4°C |
Boiling Point: | 621.1°Cat760mmHg |
Density: | 1.273g/cm3 |
Refractive index: | 1.649 |
Water Solubility: | DMSO or ethanol: soluble |
Solubility: | DMSO or ethanol: soluble |
Biological Activity: | Potent epidermal growth factor receptor (EGFR) kinase inhibitor (IC 50 = 0.7 μ M) that displays 50-fold and >140-fold selectivity over ErbB2 and insulin receptor kinase respectively. Induce G 1 growth arrest selectively in transformed cells (IC 50 values are 6.4 and 9.4 μ M in HPV16-immortalized and normal keratinocytes respectively). |
Flash Point: | 329.4°C |
Storage Temperature: | −20°C |
Safety Data |
|
 |