| Identification | |
| Name: | 2-ethylhexanoic acid, compound with 2,4,6-tris[(dimethylamino)methyl]phenol |
| Synonyms: | Hexanoic acid, 2-ethyl-, compd. with 2,4,6-tris((dimethylamino)methyl)phenol (1:?);2-Ethylhexanoic acid, compound with 2,4,6-tris((dimethylamino)methyl)phenol;Hexanoic acid, 2-ethyl-, compd. with 2,4,6-tris((dimethylamino)methyl)phenol;2-ethylhexanoic acid - 2,4,6-tris[(dimethylamino)methyl]phenol (1:1) |
| CAS: | 51365-70-9 |
| EINECS: | 257-154-9 |
| Molecular Formula: | C23H43N3O3 |
| Molecular Weight: | 409.6058 |
| InChI: | InChI=1/C15H27N3O.C8H16O2/c1-16(2)9-12-7-13(10-17(3)4)15(19)14(8-12)11-18(5)6;1-3-5-6-7(4-2)8(9)10/h7-8,19H,9-11H2,1-6H3;7H,3-6H2,1-2H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.6°C |
| Boiling Point: | 320.5°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 116.6°C |
| Safety Data | |
 |
|
