Identification |
Name: | Sulphanilic acid, compound with N,1,5-trimethylhexylamine (1:1) |
Synonyms: | Sulphanilic acid, compound with N,1,5-trimethylhexylamine (1:1);4-aminobenzenesulfonic acid; N,6-dimethylheptan-2-amine |
CAS: | 97259-83-1 |
EINECS: | 306-447-0 |
Molecular Formula: | C15H28N2O3S |
Molecular Weight: | 316.4594 |
InChI: | InChI=1/C9H21N.C6H7NO3S/c1-8(2)6-5-7-9(3)10-4;7-5-1-3-6(4-2-5)11(8,9)10/h8-10H,5-7H2,1-4H3;1-4H,7H2,(H,8,9,10) |
Molecular Structure: |
![(C15H28N2O3S) Sulphanilic acid, compound with N,1,5-trimethylhexylamine (1:1);4-aminobenzenesulfonic acid; N,6-dim...](https://img1.guidechem.com/structure/image/97259-83-1.gif) |
Properties |
Flash Point: | 478.6°Cat760mmHg |
Boiling Point: | 478.6°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 478.6°Cat760mmHg |
Safety Data |
|
![](/images/detail_15.png) |